C19H23NO4 — CID 2173279
N-[2-(2,6-dimethylphenoxy)ethyl]-3,4-dimethoxybenzamide (PubChem CID 2173279) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(2,6-dimethylphenoxy)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 2173279 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCOc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C19H23NO4/c1-13-6-5-7-14(2)18(13)24-11-10-20-19(21)15-8-9-16(22-3)17(12-15)23-4/h5-9,12H,10-11H2,1-4H3,(H,20,21) |
| InChIKey | KKQCHXPZVNPDPM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|