C25H24ClN3O4S — CID 55621985
4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-(3-phenothiazin-10-ylpropyl)benzamide (PubChem CID 55621985) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-(3-phenothiazin-10-ylpropyl)benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-(3-phenothiazin-10-ylpropyl)benzamide |
|---|---|
| PubChem CID | 55621985 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-(3-phenothiazin-10-ylpropyl)benzamide |
| SMILES | COc1cc(C(=O)NCCCN2c3ccccc3Sc3ccccc32)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C25H24ClN3O4S/c1-32-20-14-16(13-17(26)24(20)33-15-23(27)30)25(31)28-11-6-12-29-18-7-2-4-9-21(18)34-22-10-5-3-8-19(22)29/h2-5,7-10,13-14H,6,11-12,15H2,1H3,(H2,27,30)(H,28,31) |
| InChIKey | ITWQXZATUUODFG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|