C20H24ClNO4 — CID 31326626
3-chloro-5-methoxy-N-[2-(3-methylphenoxy)ethyl]-4-propoxybenzamide (PubChem CID 31326626) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is 3-chloro-5-methoxy-N-[2-(3-methylphenoxy)ethyl]-4-propoxybenzamide.
| Compound Name | 3-chloro-5-methoxy-N-[2-(3-methylphenoxy)ethyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 31326626 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-chloro-5-methoxy-N-[2-(3-methylphenoxy)ethyl]-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)NCCOc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C20H24ClNO4/c1-4-9-26-19-17(21)12-15(13-18(19)24-3)20(23)22-8-10-25-16-7-5-6-14(2)11-16/h5-7,11-13H,4,8-10H2,1-3H3,(H,22,23) |
| InChIKey | NSRRHHOXSMWAEA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|