C18H20ClNO4 — CID 86574521
2-chloro-4,5-dimethoxy-N-[2-(3-methylphenoxy)ethyl]benzamide (PubChem CID 86574521) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 2-chloro-4,5-dimethoxy-N-[2-(3-methylphenoxy)ethyl]benzamide.
| Compound Name | 2-chloro-4,5-dimethoxy-N-[2-(3-methylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 86574521 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-chloro-4,5-dimethoxy-N-[2-(3-methylphenoxy)ethyl]benzamide |
| SMILES | COc1cc(Cl)c(C(=O)NCCOc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C18H20ClNO4/c1-12-5-4-6-13(9-12)24-8-7-20-18(21)14-10-16(22-2)17(23-3)11-15(14)19/h4-6,9-11H,7-8H2,1-3H3,(H,20,21) |
| InChIKey | URCNYZSNMDWALC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|