C18H18ClFN2O4 — CID 18138817
4-(2-amino-2-oxoethoxy)-3-chloro-N-[(4-fluoro-3-methylphenyl)methyl]-5-methoxybenzamide (PubChem CID 18138817) has the molecular formula C18H18ClFN2O4 and a molecular weight of 380.80 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-N-[(4-fluoro-3-methylphenyl)methyl]-5-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[(4-fluoro-3-methylphenyl)methyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 18138817 |
| Molecular Formula | C18H18ClFN2O4 |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[(4-fluoro-3-methylphenyl)methyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(F)c(C)c2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H18ClFN2O4/c1-10-5-11(3-4-14(10)20)8-22-18(24)12-6-13(19)17(15(7-12)25-2)26-9-16(21)23/h3-7H,8-9H2,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | KLUQBVDZGCUMOL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |