C21H26N2O7 — CID 46423426
3,4,5-trimethoxy-N-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]benzamide (PubChem CID 46423426) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46423426 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]benzamide |
| SMILES | COc1cccc(OCCNC(=O)CNC(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H26N2O7/c1-26-15-6-5-7-16(12-15)30-9-8-22-19(24)13-23-21(25)14-10-17(27-2)20(29-4)18(11-14)28-3/h5-7,10-12H,8-9,13H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | DLWXWDROPGADCM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|