C18H20ClNO5 — CID 2295339
N-[2-(4-chlorophenoxy)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 2295339) has the molecular formula C18H20ClNO5 and a molecular weight of 365.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2295339 |
| Molecular Formula | C18H20ClNO5 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOc2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H20ClNO5/c1-22-15-10-12(11-16(23-2)17(15)24-3)18(21)20-8-9-25-14-6-4-13(19)5-7-14/h4-7,10-11H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | VUVDBRLHYVDBOX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|