C19H23NO6 — CID 113101923
N-[2-(2,3-dimethoxyphenoxy)ethyl]-3,5-dimethoxybenzamide (PubChem CID 113101923) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[2-(2,3-dimethoxyphenoxy)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(2,3-dimethoxyphenoxy)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 113101923 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[2-(2,3-dimethoxyphenoxy)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCOc2cccc(OC)c2OC)c1 |
| InChI | InChI=1S/C19H23NO6/c1-22-14-10-13(11-15(12-14)23-2)19(21)20-8-9-26-17-7-5-6-16(24-3)18(17)25-4/h5-7,10-12H,8-9H2,1-4H3,(H,20,21) |
| InChIKey | OEVUAPOONRSCMQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|