C25H27NO5 — CID 2225987
N-[2-(2-benzylphenoxy)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 2225987) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[2-(2-benzylphenoxy)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(2-benzylphenoxy)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2225987 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[2-(2-benzylphenoxy)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOc2ccccc2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO5/c1-28-22-16-20(17-23(29-2)24(22)30-3)25(27)26-13-14-31-21-12-8-7-11-19(21)15-18-9-5-4-6-10-18/h4-12,16-17H,13-15H2,1-3H3,(H,26,27) |
| InChIKey | AXIMZZLHBIVCNY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|