C25H27NO5 — CID 9456714
3,5-dimethoxy-N-[2-(4-methylphenoxy)ethyl]-4-phenylmethoxybenzamide (PubChem CID 9456714) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-(4-methylphenoxy)ethyl]-4-phenylmethoxybenzamide.
| Compound Name | 3,5-dimethoxy-N-[2-(4-methylphenoxy)ethyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 9456714 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3,5-dimethoxy-N-[2-(4-methylphenoxy)ethyl]-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOc2ccc(C)cc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO5/c1-18-9-11-21(12-10-18)30-14-13-26-25(27)20-15-22(28-2)24(23(16-20)29-3)31-17-19-7-5-4-6-8-19/h4-12,15-16H,13-14,17H2,1-3H3,(H,26,27) |
| InChIKey | KQBBZVJYMJSTAM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|