C24H25NO5 — CID 9456400
3,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-4-phenylmethoxybenzamide (PubChem CID 9456400) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-4-phenylmethoxybenzamide.
| Compound Name | 3,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 9456400 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-4-phenylmethoxybenzamide |
| SMILES | COc1cccc(CNC(=O)c2cc(OC)c(OCc3ccccc3)c(OC)c2)c1 |
| InChI | InChI=1S/C24H25NO5/c1-27-20-11-7-10-18(12-20)15-25-24(26)19-13-21(28-2)23(22(14-19)29-3)30-16-17-8-5-4-6-9-17/h4-14H,15-16H2,1-3H3,(H,25,26) |
| InChIKey | VIEUDTRXGXFEJO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |