C22H22N2O5 — CID 90596216
3,4,5-trimethoxy-N-[(3-pyridin-2-yloxyphenyl)methyl]benzamide (PubChem CID 90596216) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(3-pyridin-2-yloxyphenyl)methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(3-pyridin-2-yloxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 90596216 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(3-pyridin-2-yloxyphenyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2cccc(Oc3ccccn3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O5/c1-26-18-12-16(13-19(27-2)21(18)28-3)22(25)24-14-15-7-6-8-17(11-15)29-20-9-4-5-10-23-20/h4-13H,14H2,1-3H3,(H,24,25) |
| InChIKey | VUIOTKNBLPHWEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |