C19H22BrNO4 — CID 4602601
3-bromo-5-methoxy-N-(3-methoxypropyl)-4-phenylmethoxybenzamide (PubChem CID 4602601) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-bromo-5-methoxy-N-(3-methoxypropyl)-4-phenylmethoxybenzamide.
| Compound Name | 3-bromo-5-methoxy-N-(3-methoxypropyl)-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 4602601 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-bromo-5-methoxy-N-(3-methoxypropyl)-4-phenylmethoxybenzamide |
| SMILES | COCCCNC(=O)c1cc(Br)c(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H22BrNO4/c1-23-10-6-9-21-19(22)15-11-16(20)18(17(12-15)24-2)25-13-14-7-4-3-5-8-14/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3,(H,21,22) |
| InChIKey | YOMUAYICFBOEIT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|