C16H16BrNO3 — CID 1008056
N-benzyl-3-bromo-4,5-dimethoxybenzamide (PubChem CID 1008056) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-benzyl-3-bromo-4,5-dimethoxybenzamide.
| Compound Name | N-benzyl-3-bromo-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 1008056 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-benzyl-3-bromo-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccccc2)cc(Br)c1OC |
| InChI | InChI=1S/C16H16BrNO3/c1-20-14-9-12(8-13(17)15(14)21-2)16(19)18-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | YYRLFMGELKJMAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |