C24H23BrN2O5 — CID 24681669
N-[2-(2-bromoanilino)-2-oxoethyl]-3,5-dimethoxy-4-phenylmethoxybenzamide (PubChem CID 24681669) has the molecular formula C24H23BrN2O5 and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-3,5-dimethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-3,5-dimethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 24681669 |
| Molecular Formula | C24H23BrN2O5 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-3,5-dimethoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2ccccc2Br)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H23BrN2O5/c1-30-20-12-17(13-21(31-2)23(20)32-15-16-8-4-3-5-9-16)24(29)26-14-22(28)27-19-11-7-6-10-18(19)25/h3-13H,14-15H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | WIJACIRPDFEZBZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |