C25H25NO6 — CID 16567479
methyl 3-[(3,5-dimethoxy-4-phenylmethoxybenzoyl)amino]-4-methylbenzoate (PubChem CID 16567479) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is methyl 3-[(3,5-dimethoxy-4-phenylmethoxybenzoyl)amino]-4-methylbenzoate.
| Compound Name | methyl 3-[(3,5-dimethoxy-4-phenylmethoxybenzoyl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 16567479 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | methyl 3-[(3,5-dimethoxy-4-phenylmethoxybenzoyl)amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc(OC)c(OCc3ccccc3)c(OC)c2)c1 |
| InChI | InChI=1S/C25H25NO6/c1-16-10-11-18(25(28)31-4)12-20(16)26-24(27)19-13-21(29-2)23(22(14-19)30-3)32-15-17-8-6-5-7-9-17/h5-14H,15H2,1-4H3,(H,26,27) |
| InChIKey | UVYJMZKDBUXYMU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |