C23H22FNO4 — CID 9455251
N-(2-fluoro-5-methylphenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide (PubChem CID 9455251) has the molecular formula C23H22FNO4 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-(2-fluoro-5-methylphenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-(2-fluoro-5-methylphenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 9455251 |
| Molecular Formula | C23H22FNO4 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(2-fluoro-5-methylphenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(C)ccc2F)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H22FNO4/c1-15-9-10-18(24)19(11-15)25-23(26)17-12-20(27-2)22(21(13-17)28-3)29-14-16-7-5-4-6-8-16/h4-13H,14H2,1-3H3,(H,25,26) |
| InChIKey | YWFHVZRIQSFKOA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |