C35H31NO4 — CID 122498346
N-(3-methylphenyl)-3,4,5-tris(phenylmethoxy)benzamide (PubChem CID 122498346) has the molecular formula C35H31NO4 and a molecular weight of 529.64 g/mol. Its IUPAC name is N-(3-methylphenyl)-3,4,5-tris(phenylmethoxy)benzamide.
| Compound Name | N-(3-methylphenyl)-3,4,5-tris(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 122498346 |
| Molecular Formula | C35H31NO4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | N-(3-methylphenyl)-3,4,5-tris(phenylmethoxy)benzamide |
| SMILES | Cc1cccc(NC(=O)c2cc(OCc3ccccc3)c(OCc3ccccc3)c(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C35H31NO4/c1-26-12-11-19-31(20-26)36-35(37)30-21-32(38-23-27-13-5-2-6-14-27)34(40-25-29-17-9-4-10-18-29)33(22-30)39-24-28-15-7-3-8-16-28/h2-22H,23-25H2,1H3,(H,36,37) |
| InChIKey | GCKWOPMYANREOL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |