C21H17ClINO3 — CID 5017519
3-chloro-N-(3-iodophenyl)-4-methoxy-5-phenylmethoxybenzamide (PubChem CID 5017519) has the molecular formula C21H17ClINO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is 3-chloro-N-(3-iodophenyl)-4-methoxy-5-phenylmethoxybenzamide.
| Compound Name | 3-chloro-N-(3-iodophenyl)-4-methoxy-5-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 5017519 |
| Molecular Formula | C21H17ClINO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 492.99 |
| IUPAC Name | 3-chloro-N-(3-iodophenyl)-4-methoxy-5-phenylmethoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2cccc(I)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H17ClINO3/c1-26-20-18(22)10-15(21(25)24-17-9-5-8-16(23)12-17)11-19(20)27-13-14-6-3-2-4-7-14/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | XCDIGNQRTAEHNA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|