C22H19ClINO3 — CID 126370837
N-(3-chloro-4-methylphenyl)-3-iodo-4-methoxy-5-phenylmethoxybenzamide (PubChem CID 126370837) has the molecular formula C22H19ClINO3 and a molecular weight of 507.76 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-iodo-4-methoxy-5-phenylmethoxybenzamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-iodo-4-methoxy-5-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126370837 |
| Molecular Formula | C22H19ClINO3 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-iodo-4-methoxy-5-phenylmethoxybenzamide |
| SMILES | COc1c(I)cc(C(=O)Nc2ccc(C)c(Cl)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H19ClINO3/c1-14-8-9-17(12-18(14)23)25-22(26)16-10-19(24)21(27-2)20(11-16)28-13-15-6-4-3-5-7-15/h3-12H,13H2,1-2H3,(H,25,26) |
| InChIKey | YHWJNEJLTIRVQD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|