C23H22ClNO4 — CID 3889618
3-chloro-4-ethoxy-N-(3-methoxyphenyl)-5-phenylmethoxybenzamide (PubChem CID 3889618) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-(3-methoxyphenyl)-5-phenylmethoxybenzamide.
| Compound Name | 3-chloro-4-ethoxy-N-(3-methoxyphenyl)-5-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 3889618 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-chloro-4-ethoxy-N-(3-methoxyphenyl)-5-phenylmethoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2cccc(OC)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H22ClNO4/c1-3-28-22-20(24)12-17(13-21(22)29-15-16-8-5-4-6-9-16)23(26)25-18-10-7-11-19(14-18)27-2/h4-14H,3,15H2,1-2H3,(H,25,26) |
| InChIKey | QDEPXNVRHIUTAQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |