C19H21BrN2O4 — CID 26707249
4-bromo-N-[2-(2-ethylanilino)-2-oxoethyl]-3,5-dimethoxybenzamide (PubChem CID 26707249) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-ethylanilino)-2-oxoethyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-[2-(2-ethylanilino)-2-oxoethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 26707249 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 4-bromo-N-[2-(2-ethylanilino)-2-oxoethyl]-3,5-dimethoxybenzamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C19H21BrN2O4/c1-4-12-7-5-6-8-14(12)22-17(23)11-21-19(24)13-9-15(25-2)18(20)16(10-13)26-3/h5-10H,4,11H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | DUVNXCNKENTCET-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |