C21H26N2O7 — CID 108538120
N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 108538120) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 108538120 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)c2c(OC)cccc2OC)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N2O7/c1-26-14-7-6-8-15(27-2)18(14)21(25)23-10-9-22-20(24)13-11-16(28-3)19(30-5)17(12-13)29-4/h6-8,11-12H,9-10H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | PMJUBPKECVCNGJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|