C12H17NO4 — CID 4128287
2,6-dimethoxy-N-(2-methoxyethyl)benzamide (PubChem CID 4128287) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2,6-dimethoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 2,6-dimethoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 4128287 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2,6-dimethoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C12H17NO4/c1-15-8-7-13-12(14)11-9(16-2)5-4-6-10(11)17-3/h4-6H,7-8H2,1-3H3,(H,13,14) |
| InChIKey | ULJJEWKVOFYHHQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|