C15H26N4O3 — CID 59001680
N-[2-[bis(2-aminoethyl)amino]ethyl]-2,6-dimethoxybenzamide (PubChem CID 59001680) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[2-[bis(2-aminoethyl)amino]ethyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[2-[bis(2-aminoethyl)amino]ethyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 59001680 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[2-[bis(2-aminoethyl)amino]ethyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCN(CCN)CCN |
| InChI | InChI=1S/C15H26N4O3/c1-21-12-4-3-5-13(22-2)14(12)15(20)18-8-11-19(9-6-16)10-7-17/h3-5H,6-11,16-17H2,1-2H3,(H,18,20) |
| InChIKey | XEJSYZNSLHLXGD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |