C16H26N2O3 — CID 3301412
N-[3-(diethylamino)propyl]-2,6-dimethoxybenzamide (PubChem CID 3301412) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-(diethylamino)propyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 3301412 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2,6-dimethoxybenzamide |
| SMILES | CCN(CC)CCCNC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C16H26N2O3/c1-5-18(6-2)12-8-11-17-16(19)15-13(20-3)9-7-10-14(15)21-4/h7,9-10H,5-6,8,11-12H2,1-4H3,(H,17,19) |
| InChIKey | MKBVXJFSGCSYER-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|