C19H20F2N2O4 — CID 113064620
N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-2,6-dimethoxybenzamide (PubChem CID 113064620) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 113064620 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCN(C(C)=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-12(24)23(13-7-8-14(20)15(21)11-13)10-9-22-19(25)18-16(26-2)5-4-6-17(18)27-3/h4-8,11H,9-10H2,1-3H3,(H,22,25) |
| InChIKey | FNJIJZYSORSUSD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |