C19H23BrN2O4 — CID 3385993
N-[2-[(3-bromophenyl)methylamino]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 3385993) has the molecular formula C19H23BrN2O4 and a molecular weight of 423.31 g/mol. Its IUPAC name is N-[2-[(3-bromophenyl)methylamino]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(3-bromophenyl)methylamino]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3385993 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[2-[(3-bromophenyl)methylamino]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCNCc2cccc(Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23BrN2O4/c1-24-16-10-14(11-17(25-2)18(16)26-3)19(23)22-8-7-21-12-13-5-4-6-15(20)9-13/h4-6,9-11,21H,7-8,12H2,1-3H3,(H,22,23) |
| InChIKey | DRCRNTGEGCRCOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|