C19H21BrN2O4 — CID 108935128
N-[2-[[2-(3-bromophenyl)acetyl]amino]ethyl]-3,4-dimethoxybenzamide (PubChem CID 108935128) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is N-[2-[[2-(3-bromophenyl)acetyl]amino]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[[2-(3-bromophenyl)acetyl]amino]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 108935128 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[2-[[2-(3-bromophenyl)acetyl]amino]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Cc2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C19H21BrN2O4/c1-25-16-7-6-14(12-17(16)26-2)19(24)22-9-8-21-18(23)11-13-4-3-5-15(20)10-13/h3-7,10,12H,8-9,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | GISZGNUCCRAJGK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|