C25H26N2O4 — CID 108538456
N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-4-phenylbenzamide (PubChem CID 108538456) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-4-phenylbenzamide.
| Compound Name | N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 108538456 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-4-phenylbenzamide |
| SMILES | COc1ccc(CC(=O)NCCNC(=O)c2ccc(-c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H26N2O4/c1-30-22-13-8-18(16-23(22)31-2)17-24(28)26-14-15-27-25(29)21-11-9-20(10-12-21)19-6-4-3-5-7-19/h3-13,16H,14-15,17H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | LBFLSJMLCAAKME-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|