C18H28N2O4 — CID 108542599
N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-2-ethylbutanamide (PubChem CID 108542599) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-2-ethylbutanamide.
| Compound Name | N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 108542599 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCNC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-5-14(6-2)18(22)20-10-9-19-17(21)12-13-7-8-15(23-3)16(11-13)24-4/h7-8,11,14H,5-6,9-10,12H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | YPFKPIUJIXWCSS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|