C17H27NO4 — CID 165352389
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethyl-5-hydroxypentanamide (PubChem CID 165352389) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethyl-5-hydroxypentanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethyl-5-hydroxypentanamide |
|---|---|
| PubChem CID | 165352389 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethyl-5-hydroxypentanamide |
| SMILES | CCC(CCCO)C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H27NO4/c1-4-14(6-5-11-19)17(20)18-10-9-13-7-8-15(21-2)16(12-13)22-3/h7-8,12,14,19H,4-6,9-11H2,1-3H3,(H,18,20) |
| InChIKey | VPNFJYQKGWYMKR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |