C17H30N2O4 — CID 142207459
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(methylamino)pentanamide;methanol (PubChem CID 142207459) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(methylamino)pentanamide;methanol.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(methylamino)pentanamide;methanol |
|---|---|
| PubChem CID | 142207459 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(methylamino)pentanamide;methanol |
| SMILES | CCCC(NC)C(=O)NCCc1ccc(OC)c(OC)c1.CO |
| InChI | InChI=1S/C16H26N2O3.CH4O/c1-5-6-13(17-2)16(19)18-10-9-12-7-8-14(20-3)15(11-12)21-4;1-2/h7-8,11,13,17H,5-6,9-10H2,1-4H3,(H,18,19);2H,1H3 |
| InChIKey | YZQJOIZTJYUZRH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |