C16H25NO3 — CID 5073739
N-[2-(3,4-dimethoxyphenyl)ethyl]hexanamide (PubChem CID 5073739) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]hexanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]hexanamide |
|---|---|
| PubChem CID | 5073739 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H25NO3/c1-4-5-6-7-16(18)17-11-10-13-8-9-14(19-2)15(12-13)20-3/h8-9,12H,4-7,10-11H2,1-3H3,(H,17,18) |
| InChIKey | YBMQBMRDOSWAOH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|