C22H28BrNO4 — CID 19201982
4-(2-bromo-4-ethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide (PubChem CID 19201982) has the molecular formula C22H28BrNO4 and a molecular weight of 450.37 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 19201982 |
| Molecular Formula | C22H28BrNO4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide |
| SMILES | CCc1ccc(OCCCC(=O)NCCc2ccc(OC)c(OC)c2)c(Br)c1 |
| InChI | InChI=1S/C22H28BrNO4/c1-4-16-7-9-19(18(23)14-16)28-13-5-6-22(25)24-12-11-17-8-10-20(26-2)21(15-17)27-3/h7-10,14-15H,4-6,11-13H2,1-3H3,(H,24,25) |
| InChIKey | ZSBOBHHRSSIQPU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|