C22H27BrClNO4 — CID 19205915
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide (PubChem CID 19205915) has the molecular formula C22H27BrClNO4 and a molecular weight of 484.82 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 19205915 |
| Molecular Formula | C22H27BrClNO4 |
| Molecular Weight | 484.82 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide |
| SMILES | COc1ccc(CCNC(=O)CCCOc2cc(C)c(Cl)c(C)c2Br)cc1OC |
| InChI | InChI=1S/C22H27BrClNO4/c1-14-12-19(21(23)15(2)22(14)24)29-11-5-6-20(26)25-10-9-16-7-8-17(27-3)18(13-16)28-4/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,25,26) |
| InChIKey | QUDCIEQNAGZEGA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.82 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|