C21H28N2O3 — CID 109027750
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,6-dimethylanilino)propanamide (PubChem CID 109027750) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,6-dimethylanilino)propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,6-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 109027750 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,6-dimethylanilino)propanamide |
| SMILES | COc1ccc(CCNC(=O)CCNc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C21H28N2O3/c1-15-6-5-7-16(2)21(15)23-13-11-20(24)22-12-10-17-8-9-18(25-3)19(14-17)26-4/h5-9,14,23H,10-13H2,1-4H3,(H,22,24) |
| InChIKey | GRUXKMDLNFUSMG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |