C20H26N2O2 — CID 109025785
3-(2,6-dimethylanilino)-N-[2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 109025785) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(2,6-dimethylanilino)-N-[2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(2,6-dimethylanilino)-N-[2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 109025785 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-(2,6-dimethylanilino)-N-[2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCNc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-15-5-4-6-16(2)20(15)22-14-12-19(23)21-13-11-17-7-9-18(24-3)10-8-17/h4-10,22H,11-14H2,1-3H3,(H,21,23) |
| InChIKey | DRZSCXWEMFKZEJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |