C24H30Cl2N2O4 — CID 19860206
N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexanediamide (PubChem CID 19860206) has the molecular formula C24H30Cl2N2O4 and a molecular weight of 481.42 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexanediamide.
| Compound Name | N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexanediamide |
|---|---|
| PubChem CID | 19860206 |
| Molecular Formula | C24H30Cl2N2O4 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexanediamide |
| SMILES | COc1ccc(CCNC(=O)CCCCC(=O)NCCc2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C24H30Cl2N2O4/c1-31-21-10-8-18(16-22(21)32-2)12-14-28-24(30)6-4-3-5-23(29)27-13-11-17-7-9-19(25)20(26)15-17/h7-10,15-16H,3-6,11-14H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | IHVWGICKJLFLHX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|