C19H32N2O5S — CID 20629413
5-(tert-butylsulfonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]pentanamide (PubChem CID 20629413) has the molecular formula C19H32N2O5S and a molecular weight of 400.54 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 20629413 |
| Molecular Formula | C19H32N2O5S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]pentanamide |
| SMILES | COc1ccc(CCNC(=O)CCCCNS(=O)(=O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C19H32N2O5S/c1-19(2,3)27(23,24)21-12-7-6-8-18(22)20-13-11-15-9-10-16(25-4)17(14-15)26-5/h9-10,14,21H,6-8,11-13H2,1-5H3,(H,20,22) |
| InChIKey | UAIUDWOSOHYSPA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|