C24H35Cl3N2O2 — CID 44522461
N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexane-1,6-diamine;hydrochloride (PubChem CID 44522461) has the molecular formula C24H35Cl3N2O2 and a molecular weight of 489.92 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexane-1,6-diamine;hydrochloride.
| Compound Name | N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexane-1,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 44522461 |
| Molecular Formula | C24H35Cl3N2O2 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N'-[2-(3,4-dichlorophenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]hexane-1,6-diamine;hydrochloride |
| SMILES | COc1ccc(CCNCCCCCCNCCc2ccc(Cl)c(Cl)c2)cc1OC.Cl |
| InChI | InChI=1S/C24H34Cl2N2O2.ClH/c1-29-23-10-8-20(18-24(23)30-2)12-16-28-14-6-4-3-5-13-27-15-11-19-7-9-21(25)22(26)17-19;/h7-10,17-18,27-28H,3-6,11-16H2,1-2H3;1H |
| InChIKey | DTPHWVXXKVIINY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|