C15H25N3O3 — CID 77025166
5-[2-(3,4-dimethoxyphenyl)ethylamino]-N'-hydroxypentanimidamide (PubChem CID 77025166) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethylamino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77025166 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethylamino]-N'-hydroxypentanimidamide |
| SMILES | COc1ccc(CCNCCCCC(N)=NO)cc1OC |
| InChI | InChI=1S/C15H25N3O3/c1-20-13-7-6-12(11-14(13)21-2)8-10-17-9-4-3-5-15(16)18-19/h6-7,11,17,19H,3-5,8-10H2,1-2H3,(H2,16,18) |
| InChIKey | COUATBSJDHLVDM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|