C14H22N2O3 — CID 106233498
5-[(3,4-dimethoxyphenyl)methylamino]pentanamide (PubChem CID 106233498) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methylamino]pentanamide.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methylamino]pentanamide |
|---|---|
| PubChem CID | 106233498 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methylamino]pentanamide |
| SMILES | COc1ccc(CNCCCCC(N)=O)cc1OC |
| InChI | InChI=1S/C14H22N2O3/c1-18-12-7-6-11(9-13(12)19-2)10-16-8-4-3-5-14(15)17/h6-7,9,16H,3-5,8,10H2,1-2H3,(H2,15,17) |
| InChIKey | BARQZPLDNNIQGS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|