C14H23ClN2O4 — CID 17209258
2-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 17209258) has the molecular formula C14H23ClN2O4 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17209258 |
| Molecular Formula | C14H23ClN2O4 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | COCCCNCc1ccc(OCC(N)=O)c(OC)c1.Cl |
| InChI | InChI=1S/C14H22N2O4.ClH/c1-18-7-3-6-16-9-11-4-5-12(13(8-11)19-2)20-10-14(15)17;/h4-5,8,16H,3,6-7,9-10H2,1-2H3,(H2,15,17);1H |
| InChIKey | BQZIPIZJIQBKNM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|