C13H16N2O3 — CID 94074154
2-[2-methoxy-4-[(prop-2-ynylamino)methyl]phenoxy]acetamide (PubChem CID 94074154) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(prop-2-ynylamino)methyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-4-[(prop-2-ynylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 94074154 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[2-methoxy-4-[(prop-2-ynylamino)methyl]phenoxy]acetamide |
| SMILES | C#CCNCc1ccc(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-3-6-15-8-10-4-5-11(12(7-10)17-2)18-9-13(14)16/h1,4-5,7,15H,6,8-9H2,2H3,(H2,14,16) |
| InChIKey | CTXLOQPCVSUVTM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|