C14H23NO2S — CID 115639231
N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine (PubChem CID 115639231) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115639231 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine |
| SMILES | COc1ccc(CNCCCCSC)cc1OC |
| InChI | InChI=1S/C14H23NO2S/c1-16-13-7-6-12(10-14(13)17-2)11-15-8-4-5-9-18-3/h6-7,10,15H,4-5,8-9,11H2,1-3H3 |
| InChIKey | DUVXUQCFQPXCFW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|