C13H24Cl2N2O2 — CID 17294501
N'-[(3,4-dimethoxyphenyl)methyl]-N-methylpropane-1,3-diamine;dihydrochloride (PubChem CID 17294501) has the molecular formula C13H24Cl2N2O2 and a molecular weight of 311.25 g/mol. Its IUPAC name is N'-[(3,4-dimethoxyphenyl)methyl]-N-methylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[(3,4-dimethoxyphenyl)methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17294501 |
| Molecular Formula | C13H24Cl2N2O2 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N'-[(3,4-dimethoxyphenyl)methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
| SMILES | CNCCCNCc1ccc(OC)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C13H22N2O2.2ClH/c1-14-7-4-8-15-10-11-5-6-12(16-2)13(9-11)17-3;;/h5-6,9,14-15H,4,7-8,10H2,1-3H3;2*1H |
| InChIKey | IGMAJRONYOMQHE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|