C19H24Cl2N2O2 — CID 4722426
N'-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 4722426) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is N'-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4722426 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N'-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1ccc(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C19H24Cl2N2O2/c1-22-8-3-9-23-12-14-5-7-18(19(11-14)24-2)25-13-15-4-6-16(20)17(21)10-15/h4-7,10-11,22-23H,3,8-9,12-13H2,1-2H3 |
| InChIKey | OXJKMPVNBYJJOB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|