C22H26Cl2N2O3 — CID 17212147
1-[3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 17212147) has the molecular formula C22H26Cl2N2O3 and a molecular weight of 437.37 g/mol. Its IUPAC name is 1-[3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17212147 |
| Molecular Formula | C22H26Cl2N2O3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-[3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | COc1cc(CNCCCN2CCCC2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H26Cl2N2O3/c1-28-21-13-16(14-25-9-3-11-26-10-2-4-22(26)27)6-8-20(21)29-15-17-5-7-18(23)19(24)12-17/h5-8,12-13,25H,2-4,9-11,14-15H2,1H3 |
| InChIKey | AXMNWRMPQGPEPU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|