C21H28Cl4N2O3 — CID 17294256
N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride (PubChem CID 17294256) has the molecular formula C21H28Cl4N2O3 and a molecular weight of 498.28 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17294256 |
| Molecular Formula | C21H28Cl4N2O3 |
| Molecular Weight | 498.28 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
| SMILES | COc1cc(CNCCN2CCOCC2)ccc1OCc1ccc(Cl)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C21H26Cl2N2O3.2ClH/c1-26-21-13-16(14-24-6-7-25-8-10-27-11-9-25)3-5-20(21)28-15-17-2-4-18(22)19(23)12-17;;/h2-5,12-13,24H,6-11,14-15H2,1H3;2*1H |
| InChIKey | YPYQUGOUNOVRSQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|